C16H8Cl2CuN2O4 — CID 139068525
copper;3,6-dichloro-4,5-dioxocyclohexa-2,6-diene-1,2-diolate;2-pyridin-2-ylpyridine (PubChem CID 139068525) has the molecular formula C16H8Cl2CuN2O4 and a molecular weight of 426.70 g/mol. Its IUPAC name is copper;3,6-dichloro-4,5-dioxocyclohexa-2,6-diene-1,2-diolate;2-pyridin-2-ylpyridine.
| Compound Name | copper;3,6-dichloro-4,5-dioxocyclohexa-2,6-diene-1,2-diolate;2-pyridin-2-ylpyridine |
|---|---|
| PubChem CID | 139068525 |
| Molecular Formula | C16H8Cl2CuN2O4 |
| Molecular Weight | 426.70 g/mol |
| Exact Mass | 424.92 |
| IUPAC Name | copper;3,6-dichloro-4,5-dioxocyclohexa-2,6-diene-1,2-diolate;2-pyridin-2-ylpyridine |
| SMILES | O=C1C(=O)C(Cl)=C([O-])C([O-])=C1Cl.[Cu+2].c1ccc(-c2ccccn2)nc1 |
| InChI | InChI=1S/C10H8N2.C6H2Cl2O4.Cu/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;7-1-3(9)5(11)2(8)6(12)4(1)10;/h1-8H;9,11H;/q;;+2/p-2 |
| InChIKey | CPIXVOKXFQNPFT-UHFFFAOYSA-L |
| XLogP | 0.90 |
| TPSA | 106.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.70 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|