About (2-methyl-4-oxopentan-2-yl)azanium;2-sulfamoylbenzoate
(2-methyl-4-oxopentan-2-yl)azanium;2-sulfamoylbenzoate (PubChem CID 139077111) has the molecular formula C13H20N2O5S
and a molecular weight of 316.38 g/mol. Its IUPAC name is (2-methyl-4-oxopentan-2-yl)azanium;2-sulfamoylbenzoate.
Molecular Properties
| Compound Name | (2-methyl-4-oxopentan-2-yl)azanium;2-sulfamoylbenzoate |
| PubChem CID | 139077111 |
| Molecular Formula | C13H20N2O5S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | (2-methyl-4-oxopentan-2-yl)azanium;2-sulfamoylbenzoate |
| SMILES | CC(=O)CC(C)(C)[NH3+].NS(=O)(=O)c1ccccc1C(=O)[O-] |
| InChI | InChI=1S/C7H7NO4S.C6H13NO/c8-13(11,12)6-4-2-1-3-5(6)7(9)10;1-5(8)4-6(2,3)7/h1-4H,(H,9,10)(H2,8,11,12);4,7H2,1-3H3 |
| InChIKey | CQQJCNPJJDRTCI-UHFFFAOYSA-N |
| XLogP | -1.32 |
| TPSA | 145.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-methyl-4-oxopentan-2-yl)azanium;2-sulfamoylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-4-oxopentan-2-yl)azanium;2-sulfamoylbenzoate?
The IUPAC name of (2-methyl-4-oxopentan-2-yl)azanium;2-sulfamoylbenzoate (CID 139077111) is (2-methyl-4-oxopentan-2-yl)azanium;2-sulfamoylbenzoate.
What is the SMILES notation for (2-methyl-4-oxopentan-2-yl)azanium;2-sulfamoylbenzoate?
The canonical SMILES for (2-methyl-4-oxopentan-2-yl)azanium;2-sulfamoylbenzoate is CC(=O)CC(C)(C)[NH3+].NS(=O)(=O)c1ccccc1C(=O)[O-].
What is the InChIKey of (2-methyl-4-oxopentan-2-yl)azanium;2-sulfamoylbenzoate?
The InChIKey is CQQJCNPJJDRTCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO4S.C6H13NO/c8-13(11,12)6-4-2-1-3-5(6)7(9)10;1-5(8)4-6(2,3)7/h1-4H,(H,9,10)(H2,8,11,12);4,7H2,1-3H3.
What are the key properties of (2-methyl-4-oxopentan-2-yl)azanium;2-sulfamoylbenzoate?
(2-methyl-4-oxopentan-2-yl)azanium;2-sulfamoylbenzoate has a molecular weight of 316.38 g/mol, XLogP of -1.32, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-4-oxopentan-2-yl)azanium;2-sulfamoylbenzoate is sourced from PubChem (CID 139077111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).