C12H19N3O5 — CID 139081085
methanol;piperazine-1,4-diium;pyridine-2,3-dicarboxylate (PubChem CID 139081085) has the molecular formula C12H19N3O5 and a molecular weight of 285.30 g/mol. Its IUPAC name is methanol;piperazine-1,4-diium;pyridine-2,3-dicarboxylate.
| Compound Name | methanol;piperazine-1,4-diium;pyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 139081085 |
| Molecular Formula | C12H19N3O5 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | methanol;piperazine-1,4-diium;pyridine-2,3-dicarboxylate |
| SMILES | C1C[NH2+]CC[NH2+]1.CO.O=C([O-])c1cccnc1C(=O)[O-] |
| InChI | InChI=1S/C7H5NO4.C4H10N2.CH4O/c9-6(10)4-2-1-3-8-5(4)7(11)12;1-2-6-4-3-5-1;1-2/h1-3H,(H,9,10)(H,11,12);5-6H,1-4H2;2H,1H3 |
| InChIKey | FKRYAUIRYRIFCV-UHFFFAOYSA-N |
| XLogP | -5.46 |
| TPSA | 146.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | -5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |