C36H42N6O6 — CID 139088473
1-[(E)-4-(4-hydroxy-3-methoxyphenyl)butan-2-ylideneamino]-3-phenylurea (PubChem CID 139088473) has the molecular formula C36H42N6O6 and a molecular weight of 654.77 g/mol. Its IUPAC name is 1-[(E)-4-(4-hydroxy-3-methoxyphenyl)butan-2-ylideneamino]-3-phenylurea.
| Compound Name | 1-[(E)-4-(4-hydroxy-3-methoxyphenyl)butan-2-ylideneamino]-3-phenylurea |
|---|---|
| PubChem CID | 139088473 |
| Molecular Formula | C36H42N6O6 |
| Molecular Weight | 654.77 g/mol |
| Exact Mass | 654.32 |
| IUPAC Name | 1-[(E)-4-(4-hydroxy-3-methoxyphenyl)butan-2-ylideneamino]-3-phenylurea |
| SMILES | COc1cc(CC/C(C)=N/NC(=O)Nc2ccccc2)ccc1O.COc1cc(CC/C(C)=N/NC(=O)Nc2ccccc2)ccc1O |
| InChI | InChI=1S/2C18H21N3O3/c2*1-13(8-9-14-10-11-16(22)17(12-14)24-2)20-21-18(23)19-15-6-4-3-5-7-15/h2*3-7,10-12,22H,8-9H2,1-2H3,(H2,19,21,23)/b2*20-13+ |
| InChIKey | YKABCQGUQVJGGT-ACYMQGSQSA-N |
| XLogP | 7.06 |
| TPSA | 165.90 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.77 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|