C23H15Br2Cl3N2S2 — CID 139091895
3,8-bis(5-bromo-3-methylthiophen-2-yl)-1,10-phenanthroline;chloroform (PubChem CID 139091895) has the molecular formula C23H15Br2Cl3N2S2 and a molecular weight of 649.69 g/mol. Its IUPAC name is 3,8-bis(5-bromo-3-methylthiophen-2-yl)-1,10-phenanthroline;chloroform.
| Compound Name | 3,8-bis(5-bromo-3-methylthiophen-2-yl)-1,10-phenanthroline;chloroform |
|---|---|
| PubChem CID | 139091895 |
| Molecular Formula | C23H15Br2Cl3N2S2 |
| Molecular Weight | 649.69 g/mol |
| Exact Mass | 645.81 |
| IUPAC Name | 3,8-bis(5-bromo-3-methylthiophen-2-yl)-1,10-phenanthroline;chloroform |
| SMILES | Cc1cc(Br)sc1-c1cnc2c(ccc3cc(-c4sc(Br)cc4C)cnc32)c1.ClC(Cl)Cl |
| InChI | InChI=1S/C22H14Br2N2S2.CHCl3/c1-11-5-17(23)27-21(11)15-7-13-3-4-14-8-16(22-12(2)6-18(24)28-22)10-26-20(14)19(13)25-9-15;2-1(3)4/h3-10H,1-2H3;1H |
| InChIKey | JWGYMGJMCHTELK-UHFFFAOYSA-N |
| XLogP | 10.37 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.69 |
| LogP ≤ 5 | 10.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|