C28H14Br2F2N2S2 — CID 58500708
5,8-bis(5-bromothiophen-2-yl)-2,3-bis(4-fluorophenyl)quinoxaline (PubChem CID 58500708) has the molecular formula C28H14Br2F2N2S2 and a molecular weight of 640.37 g/mol. Its IUPAC name is 5,8-bis(5-bromothiophen-2-yl)-2,3-bis(4-fluorophenyl)quinoxaline.
| Compound Name | 5,8-bis(5-bromothiophen-2-yl)-2,3-bis(4-fluorophenyl)quinoxaline |
|---|---|
| PubChem CID | 58500708 |
| Molecular Formula | C28H14Br2F2N2S2 |
| Molecular Weight | 640.37 g/mol |
| Exact Mass | 637.89 |
| IUPAC Name | 5,8-bis(5-bromothiophen-2-yl)-2,3-bis(4-fluorophenyl)quinoxaline |
| SMILES | Fc1ccc(-c2nc3c(-c4ccc(Br)s4)ccc(-c4ccc(Br)s4)c3nc2-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C28H14Br2F2N2S2/c29-23-13-11-21(35-23)19-9-10-20(22-12-14-24(30)36-22)28-27(19)33-25(15-1-5-17(31)6-2-15)26(34-28)16-3-7-18(32)8-4-16/h1-14H |
| InChIKey | DSCNWZAFALNPAA-UHFFFAOYSA-N |
| XLogP | 10.22 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.37 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |