C20H11Br2Cl3N4S — CID 139091899
chloroform;3,8-dibromo-2-(1-thiophen-2-ylimidazol-2-yl)-1,10-phenanthroline (PubChem CID 139091899) has the molecular formula C20H11Br2Cl3N4S and a molecular weight of 605.57 g/mol. Its IUPAC name is chloroform;3,8-dibromo-2-(1-thiophen-2-ylimidazol-2-yl)-1,10-phenanthroline.
| Compound Name | chloroform;3,8-dibromo-2-(1-thiophen-2-ylimidazol-2-yl)-1,10-phenanthroline |
|---|---|
| PubChem CID | 139091899 |
| Molecular Formula | C20H11Br2Cl3N4S |
| Molecular Weight | 605.57 g/mol |
| Exact Mass | 601.81 |
| IUPAC Name | chloroform;3,8-dibromo-2-(1-thiophen-2-ylimidazol-2-yl)-1,10-phenanthroline |
| SMILES | Brc1cnc2c(ccc3cc(Br)c(-c4nccn4-c4cccs4)nc32)c1.ClC(Cl)Cl |
| InChI | InChI=1S/C19H10Br2N4S.CHCl3/c20-13-8-11-3-4-12-9-14(21)18(24-17(12)16(11)23-10-13)19-22-5-6-25(19)15-2-1-7-26-15;2-1(3)4/h1-10H;1H |
| InChIKey | YLLNTQZIUXBZPF-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.57 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|