C27H17Cl3N6S2 — CID 139091897
3,8-bis(5-imidazol-1-ylthiophen-2-yl)-1,10-phenanthroline;chloroform (PubChem CID 139091897) has the molecular formula C27H17Cl3N6S2 and a molecular weight of 595.97 g/mol. Its IUPAC name is 3,8-bis(5-imidazol-1-ylthiophen-2-yl)-1,10-phenanthroline;chloroform.
| Compound Name | 3,8-bis(5-imidazol-1-ylthiophen-2-yl)-1,10-phenanthroline;chloroform |
|---|---|
| PubChem CID | 139091897 |
| Molecular Formula | C27H17Cl3N6S2 |
| Molecular Weight | 595.97 g/mol |
| Exact Mass | 594.00 |
| IUPAC Name | 3,8-bis(5-imidazol-1-ylthiophen-2-yl)-1,10-phenanthroline;chloroform |
| SMILES | ClC(Cl)Cl.c1cn(-c2ccc(-c3cnc4c(ccc5cc(-c6ccc(-n7ccnc7)s6)cnc54)c3)s2)cn1 |
| InChI | InChI=1S/C26H16N6S2.CHCl3/c1-2-18-12-20(22-4-6-24(34-22)32-10-8-28-16-32)14-30-26(18)25-17(1)11-19(13-29-25)21-3-5-23(33-21)31-9-7-27-15-31;2-1(3)4/h1-16H;1H |
| InChIKey | DJSYTMDDCAOJJX-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.97 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|