C15H26O6 — CID 139092185
(3R)-3-[(4S,5S)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxy-2,2-dimethylpropanal (PubChem CID 139092185) has the molecular formula C15H26O6 and a molecular weight of 302.37 g/mol. Its IUPAC name is (3R)-3-[(4S,5S)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxy-2,2-dimethylpropanal.
| Compound Name | (3R)-3-[(4S,5S)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxy-2,2-dimethylpropanal |
|---|---|
| PubChem CID | 139092185 |
| Molecular Formula | C15H26O6 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | (3R)-3-[(4S,5S)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxy-2,2-dimethylpropanal |
| SMILES | CC1(C)O[C@@H]([C@@H]2COC(C)(C)O2)[C@H]([C@H](O)C(C)(C)C=O)O1 |
| InChI | InChI=1S/C15H26O6/c1-13(2,8-16)12(17)11-10(20-15(5,6)21-11)9-7-18-14(3,4)19-9/h8-12,17H,7H2,1-6H3/t9-,10-,11+,12-/m0/s1 |
| InChIKey | SLEQOWOELVOUJT-YFKTTZPYSA-N |
| XLogP | 1.24 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|