C20H30O6 — CID 139093093
(2S)-2-[(1S,2S,6R)-6-(5,5-dimethyl-4-oxofuran-2-yl)-1,2-dihydroxy-2-methylheptyl]-4-methyl-2,3-dihydropyran-6-one (PubChem CID 139093093) has the molecular formula C20H30O6 and a molecular weight of 366.45 g/mol. Its IUPAC name is (2S)-2-[(1S,2S,6R)-6-(5,5-dimethyl-4-oxofuran-2-yl)-1,2-dihydroxy-2-methylheptyl]-4-methyl-2,3-dihydropyran-6-one.
| Compound Name | (2S)-2-[(1S,2S,6R)-6-(5,5-dimethyl-4-oxofuran-2-yl)-1,2-dihydroxy-2-methylheptyl]-4-methyl-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 139093093 |
| Molecular Formula | C20H30O6 |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | (2S)-2-[(1S,2S,6R)-6-(5,5-dimethyl-4-oxofuran-2-yl)-1,2-dihydroxy-2-methylheptyl]-4-methyl-2,3-dihydropyran-6-one |
| SMILES | CC1=CC(=O)O[C@H]([C@H](O)[C@@](C)(O)CCC[C@@H](C)C2=CC(=O)C(C)(C)O2)C1 |
| InChI | InChI=1S/C20H30O6/c1-12-9-15(25-17(22)10-12)18(23)20(5,24)8-6-7-13(2)14-11-16(21)19(3,4)26-14/h10-11,13,15,18,23-24H,6-9H2,1-5H3/t13-,15+,18+,20+/m1/s1 |
| InChIKey | MQQVTOIWYZTLDN-VQUGOPFGSA-N |
| XLogP | 2.43 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |