C22H33NO5 — CID 139093876
tert-butyl (2R)-2-[(3aS,4S,7aR)-2,2-dimethyl-5-[(1R)-1-phenylethyl]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridin-4-yl]-2-hydroxyacetate (PubChem CID 139093876) has the molecular formula C22H33NO5 and a molecular weight of 391.51 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(3aS,4S,7aR)-2,2-dimethyl-5-[(1R)-1-phenylethyl]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridin-4-yl]-2-hydroxyacetate.
| Compound Name | tert-butyl (2R)-2-[(3aS,4S,7aR)-2,2-dimethyl-5-[(1R)-1-phenylethyl]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridin-4-yl]-2-hydroxyacetate |
|---|---|
| PubChem CID | 139093876 |
| Molecular Formula | C22H33NO5 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.24 |
| IUPAC Name | tert-butyl (2R)-2-[(3aS,4S,7aR)-2,2-dimethyl-5-[(1R)-1-phenylethyl]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridin-4-yl]-2-hydroxyacetate |
| SMILES | C[C@H](c1ccccc1)N1CC[C@H]2OC(C)(C)O[C@H]2[C@@H]1[C@@H](O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H33NO5/c1-14(15-10-8-7-9-11-15)23-13-12-16-19(27-22(5,6)26-16)17(23)18(24)20(25)28-21(2,3)4/h7-11,14,16-19,24H,12-13H2,1-6H3/t14-,16-,17+,18-,19-/m1/s1 |
| InChIKey | NJFFRENPJGHUEL-IQZDNPOKSA-N |
| XLogP | 3.04 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |