C15H19NO4 — CID 139093881
(3R,3aS,7R,7aR)-3,7-dihydroxy-4-[(1R)-1-phenylethyl]-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridin-2-one (PubChem CID 139093881) has the molecular formula C15H19NO4 and a molecular weight of 277.32 g/mol. Its IUPAC name is (3R,3aS,7R,7aR)-3,7-dihydroxy-4-[(1R)-1-phenylethyl]-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridin-2-one.
| Compound Name | (3R,3aS,7R,7aR)-3,7-dihydroxy-4-[(1R)-1-phenylethyl]-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridin-2-one |
|---|---|
| PubChem CID | 139093881 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | (3R,3aS,7R,7aR)-3,7-dihydroxy-4-[(1R)-1-phenylethyl]-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridin-2-one |
| SMILES | C[C@H](c1ccccc1)N1CC[C@@H](O)[C@@H]2OC(=O)[C@H](O)[C@@H]21 |
| InChI | InChI=1S/C15H19NO4/c1-9(10-5-3-2-4-6-10)16-8-7-11(17)14-12(16)13(18)15(19)20-14/h2-6,9,11-14,17-18H,7-8H2,1H3/t9-,11-,12+,13-,14+/m1/s1 |
| InChIKey | MDODXBKDMXVPRY-LPUQOGTASA-N |
| XLogP | 0.47 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |