C19H20F2N2OS — CID 139094229
N-benzhydryl-N-[2-(dimethylamino)-2-sulfanylideneethyl]-2,2-difluoroacetamide (PubChem CID 139094229) has the molecular formula C19H20F2N2OS and a molecular weight of 362.45 g/mol. Its IUPAC name is N-benzhydryl-N-[2-(dimethylamino)-2-sulfanylideneethyl]-2,2-difluoroacetamide.
| Compound Name | N-benzhydryl-N-[2-(dimethylamino)-2-sulfanylideneethyl]-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 139094229 |
| Molecular Formula | C19H20F2N2OS |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | N-benzhydryl-N-[2-(dimethylamino)-2-sulfanylideneethyl]-2,2-difluoroacetamide |
| SMILES | CN(C)C(=S)CN(C(=O)C(F)F)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H20F2N2OS/c1-22(2)16(25)13-23(19(24)18(20)21)17(14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12,17-18H,13H2,1-2H3 |
| InChIKey | IWLMBLMZXALXRA-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|