C20H13FN2O3Pd — CID 139097439
3-fluoro-2-(1,10-phenanthrolin-2-yl)phenolate;palladium(2+);acetate (PubChem CID 139097439) has the molecular formula C20H13FN2O3Pd and a molecular weight of 454.75 g/mol. Its IUPAC name is 3-fluoro-2-(1,10-phenanthrolin-2-yl)phenolate;palladium(2+);acetate.
| Compound Name | 3-fluoro-2-(1,10-phenanthrolin-2-yl)phenolate;palladium(2+);acetate |
|---|---|
| PubChem CID | 139097439 |
| Molecular Formula | C20H13FN2O3Pd |
| Molecular Weight | 454.75 g/mol |
| Exact Mass | 453.99 |
| IUPAC Name | 3-fluoro-2-(1,10-phenanthrolin-2-yl)phenolate;palladium(2+);acetate |
| SMILES | CC(=O)[O-].[O-]c1cccc(F)c1-c1ccc2ccc3cccnc3c2n1.[Pd+2] |
| InChI | InChI=1S/C18H11FN2O.C2H4O2.Pd/c19-13-4-1-5-15(22)16(13)14-9-8-12-7-6-11-3-2-10-20-17(11)18(12)21-14;1-2(3)4;/h1-10,22H;1H3,(H,3,4);/q;;+2/p-2 |
| InChIKey | SZFZJFAZRHQMAB-UHFFFAOYSA-L |
| XLogP | 2.42 |
| TPSA | 88.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.75 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|