C42H52BCuN6 — CID 139099004
copper(1+);hex-1-ene;tris[3-(2,4,6-trimethylphenyl)pyrazol-1-yl]boranuide (PubChem CID 139099004) has the molecular formula C42H52BCuN6 and a molecular weight of 715.28 g/mol. Its IUPAC name is copper(1+);hex-1-ene;tris[3-(2,4,6-trimethylphenyl)pyrazol-1-yl]boranuide.
| Compound Name | copper(1+);hex-1-ene;tris[3-(2,4,6-trimethylphenyl)pyrazol-1-yl]boranuide |
|---|---|
| PubChem CID | 139099004 |
| Molecular Formula | C42H52BCuN6 |
| Molecular Weight | 715.28 g/mol |
| Exact Mass | 714.36 |
| IUPAC Name | copper(1+);hex-1-ene;tris[3-(2,4,6-trimethylphenyl)pyrazol-1-yl]boranuide |
| SMILES | C=CCCCC.Cc1cc(C)c(-c2ccn([BH-](n3ccc(-c4c(C)cc(C)cc4C)n3)n3ccc(-c4c(C)cc(C)cc4C)n3)n2)c(C)c1.[Cu+] |
| InChI | InChI=1S/C36H40BN6.C6H12.Cu/c1-22-16-25(4)34(26(5)17-22)31-10-13-41(38-31)37(42-14-11-32(39-42)35-27(6)18-23(2)19-28(35)7)43-15-12-33(40-43)36-29(8)20-24(3)21-30(36)9;1-3-5-6-4-2;/h10-21,37H,1-9H3;3H,1,4-6H2,2H3;/q-1;;+1 |
| InChIKey | UYXWPKHDLJVCFV-UHFFFAOYSA-N |
| XLogP | 10.07 |
| TPSA | 53.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.28 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|