C37H41N3O6S3 — CID 139100412
(2R)-2-tert-butyl-1,6,11-tris-(4-methylphenyl)sulfonyl-1,6,11-triazacyclopentadeca-3,8,13-triyne (PubChem CID 139100412) has the molecular formula C37H41N3O6S3 and a molecular weight of 719.95 g/mol. Its IUPAC name is (2R)-2-tert-butyl-1,6,11-tris-(4-methylphenyl)sulfonyl-1,6,11-triazacyclopentadeca-3,8,13-triyne.
| Compound Name | (2R)-2-tert-butyl-1,6,11-tris-(4-methylphenyl)sulfonyl-1,6,11-triazacyclopentadeca-3,8,13-triyne |
|---|---|
| PubChem CID | 139100412 |
| Molecular Formula | C37H41N3O6S3 |
| Molecular Weight | 719.95 g/mol |
| Exact Mass | 719.22 |
| IUPAC Name | (2R)-2-tert-butyl-1,6,11-tris-(4-methylphenyl)sulfonyl-1,6,11-triazacyclopentadeca-3,8,13-triyne |
| SMILES | Cc1ccc(S(=O)(=O)N2CC#CCN(S(=O)(=O)c3ccc(C)cc3)CC#C[C@@H](C(C)(C)C)N(S(=O)(=O)c3ccc(C)cc3)CC#CC2)cc1 |
| InChI | InChI=1S/C37H41N3O6S3/c1-30-13-19-33(20-14-30)47(41,42)38-25-7-8-26-39(48(43,44)34-21-15-31(2)16-22-34)28-11-12-36(37(4,5)6)40(29-10-9-27-38)49(45,46)35-23-17-32(3)18-24-35/h13-24,36H,25-29H2,1-6H3/t36-/m0/s1 |
| InChIKey | CJKLBCYZUUAZIY-BHVANESWSA-N |
| XLogP | 4.42 |
| TPSA | 112.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.95 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|