C26H38I2O6 — CID 139114406
[(1S,3R)-3-hydroxy-4-(2-iodoethenylidene)-3,5,5-trimethylcyclohexyl] acetate (PubChem CID 139114406) has the molecular formula C26H38I2O6 and a molecular weight of 700.39 g/mol. Its IUPAC name is [(1S,3R)-3-hydroxy-4-(2-iodoethenylidene)-3,5,5-trimethylcyclohexyl] acetate.
| Compound Name | [(1S,3R)-3-hydroxy-4-(2-iodoethenylidene)-3,5,5-trimethylcyclohexyl] acetate |
|---|---|
| PubChem CID | 139114406 |
| Molecular Formula | C26H38I2O6 |
| Molecular Weight | 700.39 g/mol |
| Exact Mass | 700.08 |
| IUPAC Name | [(1S,3R)-3-hydroxy-4-(2-iodoethenylidene)-3,5,5-trimethylcyclohexyl] acetate |
| SMILES | CC(=O)O[C@H]1CC(C)(C)C(=C=CI)[C@](C)(O)C1.CC(=O)O[C@H]1CC(C)(C)C(=C=CI)[C@](C)(O)C1 |
| InChI | InChI=1S/2C13H19IO3/c2*1-9(15)17-10-7-12(2,3)11(5-6-14)13(4,16)8-10/h2*6,10,16H,7-8H2,1-4H3/t2*5?,10-,13+/m00/s1 |
| InChIKey | BTBJBBQPQYRXIF-CDTMPWNKSA-N |
| XLogP | 5.93 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.39 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|