C36H42B2N4O8 — CID 139115884
CID 139115884 (PubChem CID 139115884) has the molecular formula C36H42B2N4O8 and a molecular weight of 680.38 g/mol.
| Compound Name | CID 139115884 |
|---|---|
| PubChem CID | 139115884 |
| Molecular Formula | C36H42B2N4O8 |
| Molecular Weight | 680.38 g/mol |
| Exact Mass | 680.32 |
| IUPAC Name | — |
| SMILES | COc1ccc2c3c1O[C@@H]1CC(=O)C[C@@H](O)[C@]31CC[N@+](C)([B-]C#N)C2.COc1ccc2c3c1O[C@@H]1CC(=O)C[C@@H](O)[C@]31CC[N@+](C)([B-]C#N)C2 |
| InChI | InChI=1S/2C18H21BN2O4/c2*1-21(19-10-20)6-5-18-14(23)7-12(22)8-15(18)25-17-13(24-2)4-3-11(9-21)16(17)18/h2*3-4,14-15,23H,5-9H2,1-2H3/t2*14-,15-,18+,21+/m11/s1 |
| InChIKey | XEFDIZLPVCAICI-ZGYIZLJYSA-N |
| XLogP | 1.74 |
| TPSA | 159.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.38 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|