C13H9NO2S2 — CID 139119422
(E)-3-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2-thiophen-2-ylprop-2-enenitrile (PubChem CID 139119422) has the molecular formula C13H9NO2S2 and a molecular weight of 275.35 g/mol. Its IUPAC name is (E)-3-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2-thiophen-2-ylprop-2-enenitrile.
| Compound Name | (E)-3-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2-thiophen-2-ylprop-2-enenitrile |
|---|---|
| PubChem CID | 139119422 |
| Molecular Formula | C13H9NO2S2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.01 |
| IUPAC Name | (E)-3-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2-thiophen-2-ylprop-2-enenitrile |
| SMILES | N#C/C(=C\c1scc2c1OCCO2)c1cccs1 |
| InChI | InChI=1S/C13H9NO2S2/c14-7-9(11-2-1-5-17-11)6-12-13-10(8-18-12)15-3-4-16-13/h1-2,5-6,8H,3-4H2/b9-6+ |
| InChIKey | JMNRKYVUFHITRJ-RMKNXTFCSA-N |
| XLogP | 3.64 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|