About 2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carbonitrile
2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carbonitrile (PubChem CID 7537659) has the molecular formula C7H5NO2S
and a molecular weight of 167.19 g/mol. Its IUPAC name is 2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carbonitrile.
Analyze 2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carbonitrile?
The IUPAC name of 2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carbonitrile (CID 7537659) is 2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carbonitrile.
What is the SMILES notation for 2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carbonitrile?
The canonical SMILES for 2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carbonitrile is N#Cc1scc2c1OCCO2.
What is the InChIKey of 2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carbonitrile?
The InChIKey is HSQAPDOVCIFQCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO2S/c8-3-6-7-5(4-11-6)9-1-2-10-7/h4H,1-2H2.
What are the key properties of 2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carbonitrile?
2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carbonitrile has a molecular weight of 167.19 g/mol, XLogP of 1.39, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carbonitrile is sourced from PubChem (CID 7537659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).