C7H7ClO2S — CID 66919429
5-(chloromethyl)-2,3-dihydrothieno[3,4-b][1,4]dioxine (PubChem CID 66919429) has the molecular formula C7H7ClO2S and a molecular weight of 190.65 g/mol. Its IUPAC name is 5-(chloromethyl)-2,3-dihydrothieno[3,4-b][1,4]dioxine.
| Compound Name | 5-(chloromethyl)-2,3-dihydrothieno[3,4-b][1,4]dioxine |
|---|---|
| PubChem CID | 66919429 |
| Molecular Formula | C7H7ClO2S |
| Molecular Weight | 190.65 g/mol |
| Exact Mass | 189.99 |
| IUPAC Name | 5-(chloromethyl)-2,3-dihydrothieno[3,4-b][1,4]dioxine |
| SMILES | ClCc1scc2c1OCCO2 |
| InChI | InChI=1S/C7H7ClO2S/c8-3-6-7-5(4-11-6)9-1-2-10-7/h4H,1-3H2 |
| InChIKey | SFTLDNMXQWGURR-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.65 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|