C13H19NO5 — CID 139120573
methyl (2S,3S,8E)-2-methyl-5,12-dioxo-1-oxa-4-azacyclododec-8-ene-3-carboxylate (PubChem CID 139120573) has the molecular formula C13H19NO5 and a molecular weight of 269.30 g/mol. Its IUPAC name is methyl (2S,3S,8E)-2-methyl-5,12-dioxo-1-oxa-4-azacyclododec-8-ene-3-carboxylate.
| Compound Name | methyl (2S,3S,8E)-2-methyl-5,12-dioxo-1-oxa-4-azacyclododec-8-ene-3-carboxylate |
|---|---|
| PubChem CID | 139120573 |
| Molecular Formula | C13H19NO5 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | methyl (2S,3S,8E)-2-methyl-5,12-dioxo-1-oxa-4-azacyclododec-8-ene-3-carboxylate |
| SMILES | COC(=O)[C@H]1NC(=O)CC/C=C/CCC(=O)O[C@H]1C |
| InChI | InChI=1S/C13H19NO5/c1-9-12(13(17)18-2)14-10(15)7-5-3-4-6-8-11(16)19-9/h3-4,9,12H,5-8H2,1-2H3,(H,14,15)/b4-3+/t9-,12-/m0/s1 |
| InChIKey | VMRYHIDBBXTYFW-HUAUEDMRSA-N |
| XLogP | 0.71 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|