C46H56N4O4 — CID 139122548
5,15-bis(4-methoxyphenyl)-5,10,10,15,20,20-hexamethyl-21,22,23,24-tetrahydroporphyrin;bis(propan-2-one) (PubChem CID 139122548) has the molecular formula C46H56N4O4 and a molecular weight of 728.98 g/mol. Its IUPAC name is 5,15-bis(4-methoxyphenyl)-5,10,10,15,20,20-hexamethyl-21,22,23,24-tetrahydroporphyrin;bis(propan-2-one).
| Compound Name | 5,15-bis(4-methoxyphenyl)-5,10,10,15,20,20-hexamethyl-21,22,23,24-tetrahydroporphyrin;bis(propan-2-one) |
|---|---|
| PubChem CID | 139122548 |
| Molecular Formula | C46H56N4O4 |
| Molecular Weight | 728.98 g/mol |
| Exact Mass | 728.43 |
| IUPAC Name | 5,15-bis(4-methoxyphenyl)-5,10,10,15,20,20-hexamethyl-21,22,23,24-tetrahydroporphyrin;bis(propan-2-one) |
| SMILES | CC(C)=O.CC(C)=O.COc1ccc(C2(C)c3ccc([nH]3)C(C)(C)c3ccc([nH]3)C(C)(c3ccc(OC)cc3)c3ccc([nH]3)C(C)(C)c3ccc2[nH]3)cc1 |
| InChI | InChI=1S/C40H44N4O2.2C3H6O/c1-37(2)29-17-21-33(41-29)39(5,25-9-13-27(45-7)14-10-25)35-23-19-31(43-35)38(3,4)32-20-24-36(44-32)40(6,34-22-18-30(37)42-34)26-11-15-28(46-8)16-12-26;2*1-3(2)4/h9-24,41-44H,1-8H3;2*1-2H3 |
| InChIKey | ZFWVUGOBQGDPNS-UHFFFAOYSA-N |
| XLogP | 9.88 |
| TPSA | 115.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.98 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |