About CID 139125048
CID 139125048 (PubChem CID 139125048) has the molecular formula C11H21N2Se
and a molecular weight of 260.26 g/mol.
Molecular Properties
| Compound Name | CID 139125048 |
| PubChem CID | 139125048 |
| Molecular Formula | C11H21N2Se |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | — |
| SMILES | CC(C)N(C)/C([Se])=N/C1CCCCC1 |
| InChI | InChI=1S/C11H21N2Se/c1-9(2)13(3)11(14)12-10-7-5-4-6-8-10/h9-10H,4-8H2,1-3H3/b12-11- |
| InChIKey | BPLPFVYQSMZEPW-QXMHVHEDSA-N |
| XLogP | 2.18 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze CID 139125048 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 139125048?
The IUPAC name of CID 139125048 (CID 139125048) is not available.
What is the SMILES notation for CID 139125048?
The canonical SMILES for CID 139125048 is CC(C)N(C)/C([Se])=N/C1CCCCC1.
What is the InChIKey of CID 139125048?
The InChIKey is BPLPFVYQSMZEPW-QXMHVHEDSA-N. The full InChI is InChI=1S/C11H21N2Se/c1-9(2)13(3)11(14)12-10-7-5-4-6-8-10/h9-10H,4-8H2,1-3H3/b12-11-.
What are the key properties of CID 139125048?
CID 139125048 has a molecular weight of 260.26 g/mol, XLogP of 2.18, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 139125048 is sourced from PubChem (CID 139125048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).