C34H32I2N2O4 — CID 139125471
(4S,5R,6R)-4-(2-iodophenyl)-5-methyl-6-phenyl-1,3-oxazinan-2-one (PubChem CID 139125471) has the molecular formula C34H32I2N2O4 and a molecular weight of 786.45 g/mol. Its IUPAC name is (4S,5R,6R)-4-(2-iodophenyl)-5-methyl-6-phenyl-1,3-oxazinan-2-one.
| Compound Name | (4S,5R,6R)-4-(2-iodophenyl)-5-methyl-6-phenyl-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 139125471 |
| Molecular Formula | C34H32I2N2O4 |
| Molecular Weight | 786.45 g/mol |
| Exact Mass | 786.05 |
| IUPAC Name | (4S,5R,6R)-4-(2-iodophenyl)-5-methyl-6-phenyl-1,3-oxazinan-2-one |
| SMILES | C[C@@H]1[C@@H](c2ccccc2I)NC(=O)O[C@H]1c1ccccc1.C[C@@H]1[C@@H](c2ccccc2I)NC(=O)O[C@H]1c1ccccc1 |
| InChI | InChI=1S/2C17H16INO2/c2*1-11-15(13-9-5-6-10-14(13)18)19-17(20)21-16(11)12-7-3-2-4-8-12/h2*2-11,15-16H,1H3,(H,19,20)/t2*11-,15+,16-/m11/s1 |
| InChIKey | DAITVUJGAIBKEI-SABNGDEHSA-N |
| XLogP | 8.90 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.45 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|