C37H38BN3NiO — CID 139130919
nickel(2+);2-(2-piperazin-1-ylethyliminomethyl)phenolate;tetraphenylboranuide (PubChem CID 139130919) has the molecular formula C37H38BN3NiO and a molecular weight of 610.24 g/mol. Its IUPAC name is nickel(2+);2-(2-piperazin-1-ylethyliminomethyl)phenolate;tetraphenylboranuide.
| Compound Name | nickel(2+);2-(2-piperazin-1-ylethyliminomethyl)phenolate;tetraphenylboranuide |
|---|---|
| PubChem CID | 139130919 |
| Molecular Formula | C37H38BN3NiO |
| Molecular Weight | 610.24 g/mol |
| Exact Mass | 609.25 |
| IUPAC Name | nickel(2+);2-(2-piperazin-1-ylethyliminomethyl)phenolate;tetraphenylboranuide |
| SMILES | [Ni+2].[O-]c1ccccc1/C=N/CCN1CCNCC1.c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20B.C13H19N3O.Ni/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;17-13-4-2-1-3-12(13)11-15-7-10-16-8-5-14-6-9-16;/h1-20H;1-4,11,14,17H,5-10H2;/q-1;;+2/p-1/b;15-11+; |
| InChIKey | XNYQZSATQTWVKF-CUHYQOPPSA-M |
| XLogP | 3.15 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.24 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|