C32H50N3O3V-5 — CID 139133767
2,4-ditert-butyl-6-[2-[2-(3,5-ditert-butyl-2-oxidophenyl)azanidylethylamino]ethylamino]phenolate;oxygen(2-);vanadium (PubChem CID 139133767) has the molecular formula C32H50N3O3V-5 and a molecular weight of 575.71 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[2-[2-(3,5-ditert-butyl-2-oxidophenyl)azanidylethylamino]ethylamino]phenolate;oxygen(2-);vanadium.
| Compound Name | 2,4-ditert-butyl-6-[2-[2-(3,5-ditert-butyl-2-oxidophenyl)azanidylethylamino]ethylamino]phenolate;oxygen(2-);vanadium |
|---|---|
| PubChem CID | 139133767 |
| Molecular Formula | C32H50N3O3V-5 |
| Molecular Weight | 575.71 g/mol |
| Exact Mass | 575.33 |
| IUPAC Name | 2,4-ditert-butyl-6-[2-[2-(3,5-ditert-butyl-2-oxidophenyl)azanidylethylamino]ethylamino]phenolate;oxygen(2-);vanadium |
| SMILES | CC(C)(C)c1cc([N-]CCNCCNc2cc(C(C)(C)C)cc(C(C)(C)C)c2[O-])c([O-])c(C(C)(C)C)c1.[O-2].[V] |
| InChI | InChI=1S/C32H52N3O2.O.V/c1-29(2,3)21-17-23(31(7,8)9)27(36)25(19-21)34-15-13-33-14-16-35-26-20-22(30(4,5)6)18-24(28(26)37)32(10,11)12;;/h17-20,33-34,36-37H,13-16H2,1-12H3;;/q-1;-2;/p-2 |
| InChIKey | WSNIISKOMLGGTL-UHFFFAOYSA-L |
| XLogP | 6.61 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.71 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|