C46H56B2N4O9 — CID 139142900
bis(methyl 4-(2,2-dimethoxy-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)benzoate);hydrate (PubChem CID 139142900) has the molecular formula C46H56B2N4O9 and a molecular weight of 830.60 g/mol. Its IUPAC name is bis(methyl 4-(2,2-dimethoxy-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)benzoate);hydrate.
| Compound Name | bis(methyl 4-(2,2-dimethoxy-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)benzoate);hydrate |
|---|---|
| PubChem CID | 139142900 |
| Molecular Formula | C46H56B2N4O9 |
| Molecular Weight | 830.60 g/mol |
| Exact Mass | 830.42 |
| IUPAC Name | bis(methyl 4-(2,2-dimethoxy-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)benzoate);hydrate |
| SMILES | COC(=O)c1ccc(C2=C3C(C)=CC(C)=[N+]3[B-](OC)(OC)n3c(C)cc(C)c32)cc1.COC(=O)c1ccc(C2=C3C(C)=CC(C)=[N+]3[B-](OC)(OC)n3c(C)cc(C)c32)cc1.O |
| InChI | InChI=1S/2C23H27BN2O4.H2O/c2*1-14-12-16(3)25-21(14)20(18-8-10-19(11-9-18)23(27)28-5)22-15(2)13-17(4)26(22)24(25,29-6)30-7;/h2*8-13H,1-7H3;1H2 |
| InChIKey | JXMBUQKVESCWLU-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 136.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.60 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|