C17H14N2O6S — CID 139147928
3-carboxy-4-hydroxybenzenesulfonate;4-pyridin-1-ium-4-ylpyridine (PubChem CID 139147928) has the molecular formula C17H14N2O6S and a molecular weight of 374.37 g/mol. Its IUPAC name is 3-carboxy-4-hydroxybenzenesulfonate;4-pyridin-1-ium-4-ylpyridine.
| Compound Name | 3-carboxy-4-hydroxybenzenesulfonate;4-pyridin-1-ium-4-ylpyridine |
|---|---|
| PubChem CID | 139147928 |
| Molecular Formula | C17H14N2O6S |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | 3-carboxy-4-hydroxybenzenesulfonate;4-pyridin-1-ium-4-ylpyridine |
| SMILES | O=C(O)c1cc(S(=O)(=O)[O-])ccc1O.c1cc(-c2cc[nH+]cc2)ccn1 |
| InChI | InChI=1S/C10H8N2.C7H6O6S/c1-5-11-6-2-9(1)10-3-7-12-8-4-10;8-6-2-1-4(14(11,12)13)3-5(6)7(9)10/h1-8H;1-3,8H,(H,9,10)(H,11,12,13) |
| InChIKey | CZVAMPKHURRYPS-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 141.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|