About bis(N-[(2,3-dimethylphenyl)diazenyl]-2-methyl-N-oxidopropan-2-amine);palladium(2+)
bis(N-[(2,3-dimethylphenyl)diazenyl]-2-methyl-N-oxidopropan-2-amine);palladium(2+) (PubChem CID 139154413) has the molecular formula C24H36N6O2Pd
and a molecular weight of 547.01 g/mol. Its IUPAC name is bis(N-[(2,3-dimethylphenyl)diazenyl]-2-methyl-N-oxidopropan-2-amine);palladium(2+).
Molecular Properties
| Compound Name | bis(N-[(2,3-dimethylphenyl)diazenyl]-2-methyl-N-oxidopropan-2-amine);palladium(2+) |
| PubChem CID | 139154413 |
| Molecular Formula | C24H36N6O2Pd |
| Molecular Weight | 547.01 g/mol |
| Exact Mass | 546.19 |
| IUPAC Name | bis(N-[(2,3-dimethylphenyl)diazenyl]-2-methyl-N-oxidopropan-2-amine);palladium(2+) |
| SMILES | Cc1cccc(/N=N/N([O-])C(C)(C)C)c1C.Cc1cccc(/N=N/N([O-])C(C)(C)C)c1C.[Pd+2] |
| InChI | InChI=1S/2C12H18N3O.Pd/c2*1-9-7-6-8-11(10(9)2)13-14-15(16)12(3,4)5;/h2*6-8H,1-5H3;/q2*-1;+2/b2*14-13+; |
| InChIKey | YOOKWOIPKUBJMF-FZHLCEHXSA-N |
| XLogP | 7.80 |
| TPSA | 102.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 547.01 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze bis(N-[(2,3-dimethylphenyl)diazenyl]-2-methyl-N-oxidopropan-2-amine);palladium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(N-[(2,3-dimethylphenyl)diazenyl]-2-methyl-N-oxidopropan-2-amine);palladium(2+)?
The IUPAC name of bis(N-[(2,3-dimethylphenyl)diazenyl]-2-methyl-N-oxidopropan-2-amine);palladium(2+) (CID 139154413) is bis(N-[(2,3-dimethylphenyl)diazenyl]-2-methyl-N-oxidopropan-2-amine);palladium(2+).
What is the SMILES notation for bis(N-[(2,3-dimethylphenyl)diazenyl]-2-methyl-N-oxidopropan-2-amine);palladium(2+)?
The canonical SMILES for bis(N-[(2,3-dimethylphenyl)diazenyl]-2-methyl-N-oxidopropan-2-amine);palladium(2+) is Cc1cccc(/N=N/N([O-])C(C)(C)C)c1C.Cc1cccc(/N=N/N([O-])C(C)(C)C)c1C.[Pd+2].
What is the InChIKey of bis(N-[(2,3-dimethylphenyl)diazenyl]-2-methyl-N-oxidopropan-2-amine);palladium(2+)?
The InChIKey is YOOKWOIPKUBJMF-FZHLCEHXSA-N. The full InChI is InChI=1S/2C12H18N3O.Pd/c2*1-9-7-6-8-11(10(9)2)13-14-15(16)12(3,4)5;/h2*6-8H,1-5H3;/q2*-1;+2/b2*14-13+;.
What are the key properties of bis(N-[(2,3-dimethylphenyl)diazenyl]-2-methyl-N-oxidopropan-2-amine);palladium(2+)?
bis(N-[(2,3-dimethylphenyl)diazenyl]-2-methyl-N-oxidopropan-2-amine);palladium(2+) has a molecular weight of 547.01 g/mol, XLogP of 7.80, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(N-[(2,3-dimethylphenyl)diazenyl]-2-methyl-N-oxidopropan-2-amine);palladium(2+) is sourced from PubChem (CID 139154413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).