C20H30B2N6O2 — CID 139157785
bis(N,N-dimethylacetamide);5,7,12,14-tetrahydro-[1,4,2,3]benzodiazadiborinino[2,3-b][1,4,2,3]benzodiazadiborinine (PubChem CID 139157785) has the molecular formula C20H30B2N6O2 and a molecular weight of 408.12 g/mol. Its IUPAC name is bis(N,N-dimethylacetamide);5,7,12,14-tetrahydro-[1,4,2,3]benzodiazadiborinino[2,3-b][1,4,2,3]benzodiazadiborinine.
| Compound Name | bis(N,N-dimethylacetamide);5,7,12,14-tetrahydro-[1,4,2,3]benzodiazadiborinino[2,3-b][1,4,2,3]benzodiazadiborinine |
|---|---|
| PubChem CID | 139157785 |
| Molecular Formula | C20H30B2N6O2 |
| Molecular Weight | 408.12 g/mol |
| Exact Mass | 408.26 |
| IUPAC Name | bis(N,N-dimethylacetamide);5,7,12,14-tetrahydro-[1,4,2,3]benzodiazadiborinino[2,3-b][1,4,2,3]benzodiazadiborinine |
| SMILES | CC(=O)N(C)C.CC(=O)N(C)C.c1ccc2c(c1)NB1Nc3ccccc3NB1N2 |
| InChI | InChI=1S/C12H12B2N4.2C4H9NO/c1-2-6-10-9(5-1)15-13-14(16-10)18-12-8-4-3-7-11(12)17-13;2*1-4(6)5(2)3/h1-8,15-18H;2*1-3H3 |
| InChIKey | NXZZKVGBTTWBQJ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.12 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|