C36H28N2O10 — CID 139176396
4,6-dicarboxybenzene-1,3-dicarboxylate;bis(4-[(E)-2-pyridin-1-ium-4-ylethenyl]phenol) (PubChem CID 139176396) has the molecular formula C36H28N2O10 and a molecular weight of 648.62 g/mol. Its IUPAC name is 4,6-dicarboxybenzene-1,3-dicarboxylate;bis(4-[(E)-2-pyridin-1-ium-4-ylethenyl]phenol).
| Compound Name | 4,6-dicarboxybenzene-1,3-dicarboxylate;bis(4-[(E)-2-pyridin-1-ium-4-ylethenyl]phenol) |
|---|---|
| PubChem CID | 139176396 |
| Molecular Formula | C36H28N2O10 |
| Molecular Weight | 648.62 g/mol |
| Exact Mass | 648.17 |
| IUPAC Name | 4,6-dicarboxybenzene-1,3-dicarboxylate;bis(4-[(E)-2-pyridin-1-ium-4-ylethenyl]phenol) |
| SMILES | O=C([O-])c1cc(C(=O)[O-])c(C(=O)O)cc1C(=O)O.Oc1ccc(/C=C/c2cc[nH+]cc2)cc1.Oc1ccc(/C=C/c2cc[nH+]cc2)cc1 |
| InChI | InChI=1S/2C13H11NO.C10H6O8/c2*15-13-5-3-11(4-6-13)1-2-12-7-9-14-10-8-12;11-7(12)3-1-4(8(13)14)6(10(17)18)2-5(3)9(15)16/h2*1-10,15H;1-2H,(H,11,12)(H,13,14)(H,15,16)(H,17,18)/b2*2-1+; |
| InChIKey | LRZCMMZUYQEZTG-BUOKYLHBSA-N |
| XLogP | 2.56 |
| TPSA | 223.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.62 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |