C35H29BF2N4O4 — CID 139177322
12,12-difluoro-10,14-bis(4-nitrophenyl)-2-phenyl-13-aza-11-azonia-12-boranuidapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(20),2,4(9),10,14-pentaene (PubChem CID 139177322) has the molecular formula C35H29BF2N4O4 and a molecular weight of 618.45 g/mol. Its IUPAC name is 12,12-difluoro-10,14-bis(4-nitrophenyl)-2-phenyl-13-aza-11-azonia-12-boranuidapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(20),2,4(9),10,14-pentaene.
| Compound Name | 12,12-difluoro-10,14-bis(4-nitrophenyl)-2-phenyl-13-aza-11-azonia-12-boranuidapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(20),2,4(9),10,14-pentaene |
|---|---|
| PubChem CID | 139177322 |
| Molecular Formula | C35H29BF2N4O4 |
| Molecular Weight | 618.45 g/mol |
| Exact Mass | 618.22 |
| IUPAC Name | 12,12-difluoro-10,14-bis(4-nitrophenyl)-2-phenyl-13-aza-11-azonia-12-boranuidapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(20),2,4(9),10,14-pentaene |
| SMILES | O=[N+]([O-])c1ccc(C2=[N+]3C(=C(c4ccccc4)c4c5c(c(-c6ccc([N+](=O)[O-])cc6)n4[B-]3(F)F)CCCC5)C3=C2CCCC3)cc1 |
| InChI | InChI=1S/C35H29BF2N4O4/c37-36(38)39-32(23-14-18-25(19-15-23)41(43)44)27-10-4-6-12-29(27)34(39)31(22-8-2-1-3-9-22)35-30-13-7-5-11-28(30)33(40(35)36)24-16-20-26(21-17-24)42(45)46/h1-3,8-9,14-21H,4-7,10-13H2 |
| InChIKey | REKXHZBIWFTFCH-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 94.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.45 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|