C30H23BF2N4O4 — CID 139037274
2,2-difluoro-5,11-bis(4-nitrophenyl)-8-(2,4,6-trimethylphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 139037274) has the molecular formula C30H23BF2N4O4 and a molecular weight of 552.35 g/mol. Its IUPAC name is 2,2-difluoro-5,11-bis(4-nitrophenyl)-8-(2,4,6-trimethylphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 2,2-difluoro-5,11-bis(4-nitrophenyl)-8-(2,4,6-trimethylphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 139037274 |
| Molecular Formula | C30H23BF2N4O4 |
| Molecular Weight | 552.35 g/mol |
| Exact Mass | 552.18 |
| IUPAC Name | 2,2-difluoro-5,11-bis(4-nitrophenyl)-8-(2,4,6-trimethylphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | Cc1cc(C)c(C2=C3C=C(c4ccc([N+](=O)[O-])cc4)C=[N+]3[B-](F)(F)n3cc(-c4ccc([N+](=O)[O-])cc4)cc32)c(C)c1 |
| InChI | InChI=1S/C30H23BF2N4O4/c1-18-12-19(2)29(20(3)13-18)30-27-14-23(21-4-8-25(9-5-21)36(38)39)16-34(27)31(32,33)35-17-24(15-28(30)35)22-6-10-26(11-7-22)37(40)41/h4-17H,1-3H3 |
| InChIKey | XZHAGTDLKKYPQI-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 94.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.35 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|