C30H24N2O2 — CID 139183664
methyl (3aS,4R,5S,6aR)-1,1-dicyano-4,5,6a-triphenyl-3a,4,5,6-tetrahydropentalene-2-carboxylate (PubChem CID 139183664) has the molecular formula C30H24N2O2 and a molecular weight of 444.53 g/mol. Its IUPAC name is methyl (3aS,4R,5S,6aR)-1,1-dicyano-4,5,6a-triphenyl-3a,4,5,6-tetrahydropentalene-2-carboxylate.
| Compound Name | methyl (3aS,4R,5S,6aR)-1,1-dicyano-4,5,6a-triphenyl-3a,4,5,6-tetrahydropentalene-2-carboxylate |
|---|---|
| PubChem CID | 139183664 |
| Molecular Formula | C30H24N2O2 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | methyl (3aS,4R,5S,6aR)-1,1-dicyano-4,5,6a-triphenyl-3a,4,5,6-tetrahydropentalene-2-carboxylate |
| SMILES | COC(=O)C1=C[C@H]2[C@H](c3ccccc3)[C@@H](c3ccccc3)C[C@@]2(c2ccccc2)C1(C#N)C#N |
| InChI | InChI=1S/C30H24N2O2/c1-34-28(33)26-17-25-27(22-13-7-3-8-14-22)24(21-11-5-2-6-12-21)18-30(25,29(26,19-31)20-32)23-15-9-4-10-16-23/h2-17,24-25,27H,18H2,1H3/t24-,25+,27-,30+/m1/s1 |
| InChIKey | JUMVUMGHIWJGPL-BVSRRPCLSA-N |
| XLogP | 5.66 |
| TPSA | 73.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |