About dichloromethane;triphenyl(phenylselanyl)phosphanium;iodide
dichloromethane;triphenyl(phenylselanyl)phosphanium;iodide (PubChem CID 139183805) has the molecular formula C25H22Cl2IPSe
and a molecular weight of 630.20 g/mol. Its IUPAC name is dichloromethane;triphenyl(phenylselanyl)phosphanium;iodide.
Molecular Properties
| Compound Name | dichloromethane;triphenyl(phenylselanyl)phosphanium;iodide |
| PubChem CID | 139183805 |
| Molecular Formula | C25H22Cl2IPSe |
| Molecular Weight | 630.20 g/mol |
| Exact Mass | 629.90 |
| IUPAC Name | dichloromethane;triphenyl(phenylselanyl)phosphanium;iodide |
| SMILES | ClCCl.[I-].c1ccc([Se][P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20PSe.CH2Cl2.HI/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)26-24-19-11-4-12-20-24;2-1-3;/h1-20H;1H2;1H/q+1;;/p-1 |
| InChIKey | DFCAIEDPTJNGRG-UHFFFAOYSA-M |
| XLogP | 2.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 630.20 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dichloromethane;triphenyl(phenylselanyl)phosphanium;iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloromethane;triphenyl(phenylselanyl)phosphanium;iodide?
The IUPAC name of dichloromethane;triphenyl(phenylselanyl)phosphanium;iodide (CID 139183805) is dichloromethane;triphenyl(phenylselanyl)phosphanium;iodide.
What is the SMILES notation for dichloromethane;triphenyl(phenylselanyl)phosphanium;iodide?
The canonical SMILES for dichloromethane;triphenyl(phenylselanyl)phosphanium;iodide is ClCCl.[I-].c1ccc([Se][P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of dichloromethane;triphenyl(phenylselanyl)phosphanium;iodide?
The InChIKey is DFCAIEDPTJNGRG-UHFFFAOYSA-M. The full InChI is InChI=1S/C24H20PSe.CH2Cl2.HI/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)26-24-19-11-4-12-20-24;2-1-3;/h1-20H;1H2;1H/q+1;;/p-1.
What are the key properties of dichloromethane;triphenyl(phenylselanyl)phosphanium;iodide?
dichloromethane;triphenyl(phenylselanyl)phosphanium;iodide has a molecular weight of 630.20 g/mol, XLogP of 2.35, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichloromethane;triphenyl(phenylselanyl)phosphanium;iodide is sourced from PubChem (CID 139183805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).