C16H21IN2 — CID 139185600
(3aS)-2-cyclohexyl-3a,4-dihydro-3H-imidazo[1,5-a]indol-2-ium iodide (PubChem CID 139185600) has the molecular formula C16H21IN2 and a molecular weight of 368.26 g/mol. Its IUPAC name is (3aS)-2-cyclohexyl-3a,4-dihydro-3H-imidazo[1,5-a]indol-2-ium iodide.
| Compound Name | (3aS)-2-cyclohexyl-3a,4-dihydro-3H-imidazo[1,5-a]indol-2-ium iodide |
|---|---|
| PubChem CID | 139185600 |
| Molecular Formula | C16H21IN2 |
| Molecular Weight | 368.26 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | (3aS)-2-cyclohexyl-3a,4-dihydro-3H-imidazo[1,5-a]indol-2-ium iodide |
| SMILES | C1=[N+](C2CCCCC2)C[C@@H]2Cc3ccccc3N12.[I-] |
| InChI | InChI=1S/C16H21N2.HI/c1-2-7-14(8-3-1)17-11-15-10-13-6-4-5-9-16(13)18(15)12-17;/h4-6,9,12,14-15H,1-3,7-8,10-11H2;1H/q+1;/p-1/t15-;/m0./s1 |
| InChIKey | UMIAQSXGUGCWCI-RSAXXLAASA-M |
| XLogP | -0.19 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.26 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|