C15H18BrNO4S — CID 139191972
(4R,5R)-5-bromo-4-[(E)-but-2-en-2-yl]-3-(4-methylphenyl)sulfonyl-1,3-oxazinan-2-one (PubChem CID 139191972) has the molecular formula C15H18BrNO4S and a molecular weight of 388.28 g/mol. Its IUPAC name is (4R,5R)-5-bromo-4-[(E)-but-2-en-2-yl]-3-(4-methylphenyl)sulfonyl-1,3-oxazinan-2-one.
| Compound Name | (4R,5R)-5-bromo-4-[(E)-but-2-en-2-yl]-3-(4-methylphenyl)sulfonyl-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 139191972 |
| Molecular Formula | C15H18BrNO4S |
| Molecular Weight | 388.28 g/mol |
| Exact Mass | 387.01 |
| IUPAC Name | (4R,5R)-5-bromo-4-[(E)-but-2-en-2-yl]-3-(4-methylphenyl)sulfonyl-1,3-oxazinan-2-one |
| SMILES | C/C=C(\C)[C@@H]1[C@@H](Br)COC(=O)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H18BrNO4S/c1-4-11(3)14-13(16)9-21-15(18)17(14)22(19,20)12-7-5-10(2)6-8-12/h4-8,13-14H,9H2,1-3H3/b11-4+/t13-,14+/m0/s1 |
| InChIKey | PUHROWXCNBXMPW-FSOHGINDSA-N |
| XLogP | 3.23 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.28 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|