ethyl 7-methyltetrazolo[1,5-a]quinoline-5-carboxylate

C26H24N8O4 — CID 139193980

IUPACethyl 7-methyltetrazolo[1,5-a]quinoline-5-carboxylate
SMILESCCOC(=O)c1cc2nnnn2c2ccc(C)cc12.CCOC(=O)c1cc2nnnn2c2ccc(C)cc12
InChIInChI=1S/2C13H12N4O2/c2*1-3-19-13(18)10-7-12-14-15-16-17(12)11-5-4-8(2)6-9(10)11/h2*4-7H,3H2,1-2H3
InChIKeyHVPNGYQVYLDXDE-UHFFFAOYSA-N
MW512.53 g/mol
LogP3.53
Rot. Bonds4

About ethyl 7-methyltetrazolo[1,5-a]quinoline-5-carboxylate

ethyl 7-methyltetrazolo[1,5-a]quinoline-5-carboxylate (PubChem CID 139193980) has the molecular formula C26H24N8O4 and a molecular weight of 512.53 g/mol. Its IUPAC name is ethyl 7-methyltetrazolo[1,5-a]quinoline-5-carboxylate.

Molecular Properties

Compound Nameethyl 7-methyltetrazolo[1,5-a]quinoline-5-carboxylate
PubChem CID139193980
Molecular FormulaC26H24N8O4
Molecular Weight512.53 g/mol
Exact Mass512.19
IUPAC Nameethyl 7-methyltetrazolo[1,5-a]quinoline-5-carboxylate
SMILESCCOC(=O)c1cc2nnnn2c2ccc(C)cc12.CCOC(=O)c1cc2nnnn2c2ccc(C)cc12
InChIInChI=1S/2C13H12N4O2/c2*1-3-19-13(18)10-7-12-14-15-16-17(12)11-5-4-8(2)6-9(10)11/h2*4-7H,3H2,1-2H3
InChIKeyHVPNGYQVYLDXDE-UHFFFAOYSA-N
XLogP3.53
TPSA138.76 Ų
H-Bond Donors
H-Bond Acceptors12
Rotatable Bonds4
Heavy Atoms38
Complexity

Lipinski Rule of Five

2 violations

RuleValue
MW ≤ 500512.53
LogP ≤ 53.53
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 1012

Analyze ethyl 7-methyltetrazolo[1,5-a]quinoline-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 7-methyltetrazolo[1,5-a]quinoline-5-carboxylate?
The IUPAC name of ethyl 7-methyltetrazolo[1,5-a]quinoline-5-carboxylate (CID 139193980) is ethyl 7-methyltetrazolo[1,5-a]quinoline-5-carboxylate.
What is the SMILES notation for ethyl 7-methyltetrazolo[1,5-a]quinoline-5-carboxylate?
The canonical SMILES for ethyl 7-methyltetrazolo[1,5-a]quinoline-5-carboxylate is CCOC(=O)c1cc2nnnn2c2ccc(C)cc12.CCOC(=O)c1cc2nnnn2c2ccc(C)cc12.
What is the InChIKey of ethyl 7-methyltetrazolo[1,5-a]quinoline-5-carboxylate?
The InChIKey is HVPNGYQVYLDXDE-UHFFFAOYSA-N. The full InChI is InChI=1S/2C13H12N4O2/c2*1-3-19-13(18)10-7-12-14-15-16-17(12)11-5-4-8(2)6-9(10)11/h2*4-7H,3H2,1-2H3.
What are the key properties of ethyl 7-methyltetrazolo[1,5-a]quinoline-5-carboxylate?
ethyl 7-methyltetrazolo[1,5-a]quinoline-5-carboxylate has a molecular weight of 512.53 g/mol, XLogP of 3.53, 4 rotatable bonds, 0 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 7-methyltetrazolo[1,5-a]quinoline-5-carboxylate is sourced from PubChem (CID 139193980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).