About 2-[1-(azaniumylmethyl)cyclohexyl]acetate;heptahydrate
2-[1-(azaniumylmethyl)cyclohexyl]acetate;heptahydrate (PubChem CID 139197548) has the molecular formula C9H31NO9
and a molecular weight of 297.35 g/mol. Its IUPAC name is 2-[1-(azaniumylmethyl)cyclohexyl]acetate;heptahydrate.
Molecular Properties
| Compound Name | 2-[1-(azaniumylmethyl)cyclohexyl]acetate;heptahydrate |
| PubChem CID | 139197548 |
| Molecular Formula | C9H31NO9 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.20 |
| IUPAC Name | 2-[1-(azaniumylmethyl)cyclohexyl]acetate;heptahydrate |
| SMILES | O.O.O.O.O.O.O.[NH3+]CC1(CC(=O)[O-])CCCCC1 |
| InChI | InChI=1S/C9H17NO2.7H2O/c10-7-9(6-8(11)12)4-2-1-3-5-9;;;;;;;/h1-7,10H2,(H,11,12);7*1H2 |
| InChIKey | PUUQQSLFBJYSHX-UHFFFAOYSA-N |
| XLogP | -6.45 |
| TPSA | 288.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | -6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[1-(azaniumylmethyl)cyclohexyl]acetate;heptahydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(azaniumylmethyl)cyclohexyl]acetate;heptahydrate?
The IUPAC name of 2-[1-(azaniumylmethyl)cyclohexyl]acetate;heptahydrate (CID 139197548) is 2-[1-(azaniumylmethyl)cyclohexyl]acetate;heptahydrate.
What is the SMILES notation for 2-[1-(azaniumylmethyl)cyclohexyl]acetate;heptahydrate?
The canonical SMILES for 2-[1-(azaniumylmethyl)cyclohexyl]acetate;heptahydrate is O.O.O.O.O.O.O.[NH3+]CC1(CC(=O)[O-])CCCCC1.
What is the InChIKey of 2-[1-(azaniumylmethyl)cyclohexyl]acetate;heptahydrate?
The InChIKey is PUUQQSLFBJYSHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2.7H2O/c10-7-9(6-8(11)12)4-2-1-3-5-9;;;;;;;/h1-7,10H2,(H,11,12);7*1H2.
What are the key properties of 2-[1-(azaniumylmethyl)cyclohexyl]acetate;heptahydrate?
2-[1-(azaniumylmethyl)cyclohexyl]acetate;heptahydrate has a molecular weight of 297.35 g/mol, XLogP of -6.45, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(azaniumylmethyl)cyclohexyl]acetate;heptahydrate is sourced from PubChem (CID 139197548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).