C17H17NO7 — CID 139197912
dimethyl (3aR,7R)-7-methyl-4-oxo-3a-phenyl-6,7-dihydro-[1,2]oxazolo[3,2-c][1,4]oxazine-2,3-dicarboxylate (PubChem CID 139197912) has the molecular formula C17H17NO7 and a molecular weight of 347.32 g/mol. Its IUPAC name is dimethyl (3aR,7R)-7-methyl-4-oxo-3a-phenyl-6,7-dihydro-[1,2]oxazolo[3,2-c][1,4]oxazine-2,3-dicarboxylate.
| Compound Name | dimethyl (3aR,7R)-7-methyl-4-oxo-3a-phenyl-6,7-dihydro-[1,2]oxazolo[3,2-c][1,4]oxazine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 139197912 |
| Molecular Formula | C17H17NO7 |
| Molecular Weight | 347.32 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | dimethyl (3aR,7R)-7-methyl-4-oxo-3a-phenyl-6,7-dihydro-[1,2]oxazolo[3,2-c][1,4]oxazine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@]2(c3ccccc3)C(=O)OC[C@@H](C)N2O1 |
| InChI | InChI=1S/C17H17NO7/c1-10-9-24-16(21)17(11-7-5-4-6-8-11)12(14(19)22-2)13(15(20)23-3)25-18(10)17/h4-8,10H,9H2,1-3H3/t10-,17-/m1/s1 |
| InChIKey | OIXIPIKKWWLELN-BMLIUANNSA-N |
| XLogP | 0.67 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.32 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|