About pyridin-1-ium-3-ylmethyl-[2-(pyridin-1-ium-3-ylmethylazaniumyl)ethyl]azanium tetrachloride
pyridin-1-ium-3-ylmethyl-[2-(pyridin-1-ium-3-ylmethylazaniumyl)ethyl]azanium tetrachloride (PubChem CID 139199077) has the molecular formula C14H22Cl4N4
and a molecular weight of 388.17 g/mol. Its IUPAC name is pyridin-1-ium-3-ylmethyl-[2-(pyridin-1-ium-3-ylmethylazaniumyl)ethyl]azanium tetrachloride.
Molecular Properties
| Compound Name | pyridin-1-ium-3-ylmethyl-[2-(pyridin-1-ium-3-ylmethylazaniumyl)ethyl]azanium tetrachloride |
| PubChem CID | 139199077 |
| Molecular Formula | C14H22Cl4N4 |
| Molecular Weight | 388.17 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | pyridin-1-ium-3-ylmethyl-[2-(pyridin-1-ium-3-ylmethylazaniumyl)ethyl]azanium tetrachloride |
| SMILES | [Cl-].[Cl-].[Cl-].[Cl-].c1c[nH+]cc(C[NH2+]CC[NH2+]Cc2ccc[nH+]c2)c1 |
| InChI | InChI=1S/C14H18N4.4ClH/c1-3-13(9-15-5-1)11-17-7-8-18-12-14-4-2-6-16-10-14;;;;/h1-6,9-10,17-18H,7-8,11-12H2;4*1H |
| InChIKey | PHWRSQDAURZCHI-UHFFFAOYSA-N |
| XLogP | -13.84 |
| TPSA | 61.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.17 |
| LogP ≤ 5 | -13.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze pyridin-1-ium-3-ylmethyl-[2-(pyridin-1-ium-3-ylmethylazaniumyl)ethyl]azanium tetrachloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-1-ium-3-ylmethyl-[2-(pyridin-1-ium-3-ylmethylazaniumyl)ethyl]azanium tetrachloride?
The IUPAC name of pyridin-1-ium-3-ylmethyl-[2-(pyridin-1-ium-3-ylmethylazaniumyl)ethyl]azanium tetrachloride (CID 139199077) is pyridin-1-ium-3-ylmethyl-[2-(pyridin-1-ium-3-ylmethylazaniumyl)ethyl]azanium tetrachloride.
What is the SMILES notation for pyridin-1-ium-3-ylmethyl-[2-(pyridin-1-ium-3-ylmethylazaniumyl)ethyl]azanium tetrachloride?
The canonical SMILES for pyridin-1-ium-3-ylmethyl-[2-(pyridin-1-ium-3-ylmethylazaniumyl)ethyl]azanium tetrachloride is [Cl-].[Cl-].[Cl-].[Cl-].c1c[nH+]cc(C[NH2+]CC[NH2+]Cc2ccc[nH+]c2)c1.
What is the InChIKey of pyridin-1-ium-3-ylmethyl-[2-(pyridin-1-ium-3-ylmethylazaniumyl)ethyl]azanium tetrachloride?
The InChIKey is PHWRSQDAURZCHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N4.4ClH/c1-3-13(9-15-5-1)11-17-7-8-18-12-14-4-2-6-16-10-14;;;;/h1-6,9-10,17-18H,7-8,11-12H2;4*1H.
What are the key properties of pyridin-1-ium-3-ylmethyl-[2-(pyridin-1-ium-3-ylmethylazaniumyl)ethyl]azanium tetrachloride?
pyridin-1-ium-3-ylmethyl-[2-(pyridin-1-ium-3-ylmethylazaniumyl)ethyl]azanium tetrachloride has a molecular weight of 388.17 g/mol, XLogP of -13.84, 7 rotatable bonds, 2 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-1-ium-3-ylmethyl-[2-(pyridin-1-ium-3-ylmethylazaniumyl)ethyl]azanium tetrachloride is sourced from PubChem (CID 139199077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).