C9H14N4S+2 — CID 4740834
5-(pyridin-1-ium-3-ylmethyl)-1,3,5-triazinan-5-ium-2-thione (PubChem CID 4740834) has the molecular formula C9H14N4S+2 and a molecular weight of 210.31 g/mol. Its IUPAC name is 5-(pyridin-1-ium-3-ylmethyl)-1,3,5-triazinan-5-ium-2-thione.
| Compound Name | 5-(pyridin-1-ium-3-ylmethyl)-1,3,5-triazinan-5-ium-2-thione |
|---|---|
| PubChem CID | 4740834 |
| Molecular Formula | C9H14N4S+2 |
| Molecular Weight | 210.31 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 5-(pyridin-1-ium-3-ylmethyl)-1,3,5-triazinan-5-ium-2-thione |
| SMILES | S=C1NC[NH+](Cc2ccc[nH+]c2)CN1 |
| InChI | InChI=1S/C9H12N4S/c14-9-11-6-13(7-12-9)5-8-2-1-3-10-4-8/h1-4H,5-7H2,(H2,11,12,14)/p+2 |
| InChIKey | ZVEWRJVFPKRKHG-UHFFFAOYSA-P |
| XLogP | -1.72 |
| TPSA | 42.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.31 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|