C14H22Cl4N4O16 — CID 139199082
pyridin-1-ium-3-ylmethyl-[2-(pyridin-1-ium-3-ylmethylazaniumyl)ethyl]azanium tetraperchlorate (PubChem CID 139199082) has the molecular formula C14H22Cl4N4O16 and a molecular weight of 644.15 g/mol. Its IUPAC name is pyridin-1-ium-3-ylmethyl-[2-(pyridin-1-ium-3-ylmethylazaniumyl)ethyl]azanium tetraperchlorate.
| Compound Name | pyridin-1-ium-3-ylmethyl-[2-(pyridin-1-ium-3-ylmethylazaniumyl)ethyl]azanium tetraperchlorate |
|---|---|
| PubChem CID | 139199082 |
| Molecular Formula | C14H22Cl4N4O16 |
| Molecular Weight | 644.15 g/mol |
| Exact Mass | 641.98 |
| IUPAC Name | pyridin-1-ium-3-ylmethyl-[2-(pyridin-1-ium-3-ylmethylazaniumyl)ethyl]azanium tetraperchlorate |
| SMILES | [O-][Cl+3]([O-])([O-])[O-].[O-][Cl+3]([O-])([O-])[O-].[O-][Cl+3]([O-])([O-])[O-].[O-][Cl+3]([O-])([O-])[O-].c1c[nH+]cc(C[NH2+]CC[NH2+]Cc2ccc[nH+]c2)c1 |
| InChI | InChI=1S/C14H18N4.4ClHO4/c1-3-13(9-15-5-1)11-17-7-8-18-12-14-4-2-6-16-10-14;4*2-1(3,4)5/h1-6,9-10,17-18H,7-8,11-12H2;4*(H,2,3,4,5) |
| InChIKey | HNPZMZPHBCQCJY-UHFFFAOYSA-N |
| XLogP | -20.88 |
| TPSA | 430.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.15 |
| LogP ≤ 5 | -20.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|