About tribenzylsulfanium perchlorate
tribenzylsulfanium perchlorate (PubChem CID 158591574) has the molecular formula C21H21ClO4S
and a molecular weight of 404.92 g/mol. Its IUPAC name is tribenzylsulfanium perchlorate.
Molecular Properties
| Compound Name | tribenzylsulfanium perchlorate |
| PubChem CID | 158591574 |
| Molecular Formula | C21H21ClO4S |
| Molecular Weight | 404.92 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | tribenzylsulfanium perchlorate |
| SMILES | [O-][Cl+3]([O-])([O-])[O-].c1ccc(C[S+](Cc2ccccc2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C21H21S.ClHO4/c1-4-10-19(11-5-1)16-22(17-20-12-6-2-7-13-20)18-21-14-8-3-9-15-21;2-1(3,4)5/h1-15H,16-18H2;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | HUMVBBSFDGBCKA-UHFFFAOYSA-M |
| XLogP | 0.45 |
| TPSA | 92.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.92 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze tribenzylsulfanium perchlorate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tribenzylsulfanium perchlorate?
The IUPAC name of tribenzylsulfanium perchlorate (CID 158591574) is tribenzylsulfanium perchlorate.
What is the SMILES notation for tribenzylsulfanium perchlorate?
The canonical SMILES for tribenzylsulfanium perchlorate is [O-][Cl+3]([O-])([O-])[O-].c1ccc(C[S+](Cc2ccccc2)Cc2ccccc2)cc1.
What is the InChIKey of tribenzylsulfanium perchlorate?
The InChIKey is HUMVBBSFDGBCKA-UHFFFAOYSA-M. The full InChI is InChI=1S/C21H21S.ClHO4/c1-4-10-19(11-5-1)16-22(17-20-12-6-2-7-13-20)18-21-14-8-3-9-15-21;2-1(3,4)5/h1-15H,16-18H2;(H,2,3,4,5)/q+1;/p-1.
What are the key properties of tribenzylsulfanium perchlorate?
tribenzylsulfanium perchlorate has a molecular weight of 404.92 g/mol, XLogP of 0.45, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tribenzylsulfanium perchlorate is sourced from PubChem (CID 158591574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).