About benzyl(diethyl)sulfanium chloride
benzyl(diethyl)sulfanium chloride (PubChem CID 23454507) has the molecular formula C11H17ClS
and a molecular weight of 216.78 g/mol. Its IUPAC name is benzyl(diethyl)sulfanium chloride.
Molecular Properties
| Compound Name | benzyl(diethyl)sulfanium chloride |
| PubChem CID | 23454507 |
| Molecular Formula | C11H17ClS |
| Molecular Weight | 216.78 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | benzyl(diethyl)sulfanium chloride |
| SMILES | CC[S+](CC)Cc1ccccc1.[Cl-] |
| InChI | InChI=1S/C11H17S.ClH/c1-3-12(4-2)10-11-8-6-5-7-9-11;/h5-9H,3-4,10H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | GDKSGUPCUITVJN-UHFFFAOYSA-M |
| XLogP | -0.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.78 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze benzyl(diethyl)sulfanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl(diethyl)sulfanium chloride?
The IUPAC name of benzyl(diethyl)sulfanium chloride (CID 23454507) is benzyl(diethyl)sulfanium chloride.
What is the SMILES notation for benzyl(diethyl)sulfanium chloride?
The canonical SMILES for benzyl(diethyl)sulfanium chloride is CC[S+](CC)Cc1ccccc1.[Cl-].
What is the InChIKey of benzyl(diethyl)sulfanium chloride?
The InChIKey is GDKSGUPCUITVJN-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H17S.ClH/c1-3-12(4-2)10-11-8-6-5-7-9-11;/h5-9H,3-4,10H2,1-2H3;1H/q+1;/p-1.
What are the key properties of benzyl(diethyl)sulfanium chloride?
benzyl(diethyl)sulfanium chloride has a molecular weight of 216.78 g/mol, XLogP of -0.15, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl(diethyl)sulfanium chloride is sourced from PubChem (CID 23454507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).