About antimony(5+);dibenzyl(phenyl)sulfanium;hexafluoride
antimony(5+);dibenzyl(phenyl)sulfanium;hexafluoride (PubChem CID 170839039) has the molecular formula C20H19F6SSb
and a molecular weight of 527.19 g/mol. Its IUPAC name is antimony(5+);dibenzyl(phenyl)sulfanium;hexafluoride.
Molecular Properties
| Compound Name | antimony(5+);dibenzyl(phenyl)sulfanium;hexafluoride |
| PubChem CID | 170839039 |
| Molecular Formula | C20H19F6SSb |
| Molecular Weight | 527.19 g/mol |
| Exact Mass | 526.01 |
| IUPAC Name | antimony(5+);dibenzyl(phenyl)sulfanium;hexafluoride |
| SMILES | [F-].[F-].[F-].[F-].[F-].[F-].[Sb+5].c1ccc(C[S+](Cc2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H19S.6FH.Sb/c1-4-10-18(11-5-1)16-21(20-14-8-3-9-15-20)17-19-12-6-2-7-13-19;;;;;;;/h1-15H,16-17H2;6*1H;/q+1;;;;;;;+5/p-6 |
| InChIKey | LYMXRISDXSCHPR-UHFFFAOYSA-H |
| XLogP | -13.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 527.19 |
| LogP ≤ 5 | -13.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze antimony(5+);dibenzyl(phenyl)sulfanium;hexafluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of antimony(5+);dibenzyl(phenyl)sulfanium;hexafluoride?
The IUPAC name of antimony(5+);dibenzyl(phenyl)sulfanium;hexafluoride (CID 170839039) is antimony(5+);dibenzyl(phenyl)sulfanium;hexafluoride.
What is the SMILES notation for antimony(5+);dibenzyl(phenyl)sulfanium;hexafluoride?
The canonical SMILES for antimony(5+);dibenzyl(phenyl)sulfanium;hexafluoride is [F-].[F-].[F-].[F-].[F-].[F-].[Sb+5].c1ccc(C[S+](Cc2ccccc2)c2ccccc2)cc1.
What is the InChIKey of antimony(5+);dibenzyl(phenyl)sulfanium;hexafluoride?
The InChIKey is LYMXRISDXSCHPR-UHFFFAOYSA-H. The full InChI is InChI=1S/C20H19S.6FH.Sb/c1-4-10-18(11-5-1)16-21(20-14-8-3-9-15-20)17-19-12-6-2-7-13-19;;;;;;;/h1-15H,16-17H2;6*1H;/q+1;;;;;;;+5/p-6.
What are the key properties of antimony(5+);dibenzyl(phenyl)sulfanium;hexafluoride?
antimony(5+);dibenzyl(phenyl)sulfanium;hexafluoride has a molecular weight of 527.19 g/mol, XLogP of -13.29, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for antimony(5+);dibenzyl(phenyl)sulfanium;hexafluoride is sourced from PubChem (CID 170839039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).