About benzyl-ethyl-(4-hydroxyphenyl)sulfanium;hexafluoroarsenic(1-)
benzyl-ethyl-(4-hydroxyphenyl)sulfanium;hexafluoroarsenic(1-) (PubChem CID 14876330) has the molecular formula C15H17AsF6OS
and a molecular weight of 434.28 g/mol. Its IUPAC name is benzyl-ethyl-(4-hydroxyphenyl)sulfanium;hexafluoroarsenic(1-).
Molecular Properties
| Compound Name | benzyl-ethyl-(4-hydroxyphenyl)sulfanium;hexafluoroarsenic(1-) |
| PubChem CID | 14876330 |
| Molecular Formula | C15H17AsF6OS |
| Molecular Weight | 434.28 g/mol |
| Exact Mass | 434.01 |
| IUPAC Name | benzyl-ethyl-(4-hydroxyphenyl)sulfanium;hexafluoroarsenic(1-) |
| SMILES | CC[S+](Cc1ccccc1)c1ccc(O)cc1.F[As-](F)(F)(F)(F)F |
| InChI | InChI=1S/C15H16OS.AsF6/c1-2-17(12-13-6-4-3-5-7-13)15-10-8-14(16)9-11-15;2-1(3,4,5,6)7/h3-11H,2,12H2,1H3;/q;-1/p+1 |
| InChIKey | IZJHOVFRVWSZAS-UHFFFAOYSA-O |
| XLogP | 5.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.28 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze benzyl-ethyl-(4-hydroxyphenyl)sulfanium;hexafluoroarsenic(1-) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl-ethyl-(4-hydroxyphenyl)sulfanium;hexafluoroarsenic(1-)?
The IUPAC name of benzyl-ethyl-(4-hydroxyphenyl)sulfanium;hexafluoroarsenic(1-) (CID 14876330) is benzyl-ethyl-(4-hydroxyphenyl)sulfanium;hexafluoroarsenic(1-).
What is the SMILES notation for benzyl-ethyl-(4-hydroxyphenyl)sulfanium;hexafluoroarsenic(1-)?
The canonical SMILES for benzyl-ethyl-(4-hydroxyphenyl)sulfanium;hexafluoroarsenic(1-) is CC[S+](Cc1ccccc1)c1ccc(O)cc1.F[As-](F)(F)(F)(F)F.
What is the InChIKey of benzyl-ethyl-(4-hydroxyphenyl)sulfanium;hexafluoroarsenic(1-)?
The InChIKey is IZJHOVFRVWSZAS-UHFFFAOYSA-O. The full InChI is InChI=1S/C15H16OS.AsF6/c1-2-17(12-13-6-4-3-5-7-13)15-10-8-14(16)9-11-15;2-1(3,4,5,6)7/h3-11H,2,12H2,1H3;/q;-1/p+1.
What are the key properties of benzyl-ethyl-(4-hydroxyphenyl)sulfanium;hexafluoroarsenic(1-)?
benzyl-ethyl-(4-hydroxyphenyl)sulfanium;hexafluoroarsenic(1-) has a molecular weight of 434.28 g/mol, XLogP of 5.73, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl-ethyl-(4-hydroxyphenyl)sulfanium;hexafluoroarsenic(1-) is sourced from PubChem (CID 14876330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).