About benzyl(diethyl)sulfanium hydroxide
benzyl(diethyl)sulfanium hydroxide (PubChem CID 161058007) has the molecular formula C11H18OS
and a molecular weight of 198.33 g/mol. Its IUPAC name is benzyl(diethyl)sulfanium hydroxide.
Molecular Properties
| Compound Name | benzyl(diethyl)sulfanium hydroxide |
| PubChem CID | 161058007 |
| Molecular Formula | C11H18OS |
| Molecular Weight | 198.33 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | benzyl(diethyl)sulfanium hydroxide |
| SMILES | CC[S+](CC)Cc1ccccc1.[OH-] |
| InChI | InChI=1S/C11H17S.H2O/c1-3-12(4-2)10-11-8-6-5-7-9-11;/h5-9H,3-4,10H2,1-2H3;1H2/q+1;/p-1 |
| InChIKey | UCZYONJECCAPSA-UHFFFAOYSA-M |
| XLogP | 2.67 |
| TPSA | 30.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze benzyl(diethyl)sulfanium hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl(diethyl)sulfanium hydroxide?
The IUPAC name of benzyl(diethyl)sulfanium hydroxide (CID 161058007) is benzyl(diethyl)sulfanium hydroxide.
What is the SMILES notation for benzyl(diethyl)sulfanium hydroxide?
The canonical SMILES for benzyl(diethyl)sulfanium hydroxide is CC[S+](CC)Cc1ccccc1.[OH-].
What is the InChIKey of benzyl(diethyl)sulfanium hydroxide?
The InChIKey is UCZYONJECCAPSA-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H17S.H2O/c1-3-12(4-2)10-11-8-6-5-7-9-11;/h5-9H,3-4,10H2,1-2H3;1H2/q+1;/p-1.
What are the key properties of benzyl(diethyl)sulfanium hydroxide?
benzyl(diethyl)sulfanium hydroxide has a molecular weight of 198.33 g/mol, XLogP of 2.67, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl(diethyl)sulfanium hydroxide is sourced from PubChem (CID 161058007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).