C32H26Cl2N2O2 — CID 139204780
4,6-dichlorobenzene-1,3-diol;bis(4-[(E)-2-phenylethenyl]pyridine) (PubChem CID 139204780) has the molecular formula C32H26Cl2N2O2 and a molecular weight of 541.48 g/mol. Its IUPAC name is 4,6-dichlorobenzene-1,3-diol;bis(4-[(E)-2-phenylethenyl]pyridine).
| Compound Name | 4,6-dichlorobenzene-1,3-diol;bis(4-[(E)-2-phenylethenyl]pyridine) |
|---|---|
| PubChem CID | 139204780 |
| Molecular Formula | C32H26Cl2N2O2 |
| Molecular Weight | 541.48 g/mol |
| Exact Mass | 540.14 |
| IUPAC Name | 4,6-dichlorobenzene-1,3-diol;bis(4-[(E)-2-phenylethenyl]pyridine) |
| SMILES | C(=C/c1ccncc1)\c1ccccc1.C(=C/c1ccncc1)\c1ccccc1.Oc1cc(O)c(Cl)cc1Cl |
| InChI | InChI=1S/2C13H11N.C6H4Cl2O2/c2*1-2-4-12(5-3-1)6-7-13-8-10-14-11-9-13;7-3-1-4(8)6(10)2-5(3)9/h2*1-11H;1-2,9-10H/b2*7-6+; |
| InChIKey | CLCHAFGSRXSRPD-RWUXNGIBSA-N |
| XLogP | 8.91 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.48 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |